CAS 861333-02-0 appears in our catalog under these names: N'-(3-Aminophenyl)ethanediamide, 95%, N'-(3-Aminophenyl)ethanediamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
N'-(3-aminophenyl)oxamide (CAS 861333-02-0) is a chemical compound with the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. IUPAC name: N'-(3-aminophenyl)oxamide. InChIKey: JAPHACUWYUPYGE-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O2 |
|---|---|
| Molecular weight | 179.18 g/mol |
| IUPAC name | N'-(3-aminophenyl)oxamide |
| InChIKey | JAPHACUWYUPYGE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)C(=O)N)N |
Computed by PubChem (NCBI)