CAS 86208-18-6 appears in our catalog under these names: 3-{4-[(tert-butoxy)carbonyl]phenyl}propanoic acid, 98%, 98%, 3-(4-(tert-Butoxycarbonyl)phenyl)propanoic acid, 98%, 3-{4-[(tert-butoxy)carbonyl]phenyl}propanoic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]propanoic acid (CAS 86208-18-6) is a chemical compound with the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. IUPAC name: 3-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]propanoic acid. InChIKey: BVRFVGOIELRZBU-UHFFFAOYSA-N.
| Molecular formula | C14H18O4 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | 3-[4-[(2-methylpropan-2-yl)oxycarbonyl]phenyl]propanoic acid |
| InChIKey | BVRFVGOIELRZBU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=C(C=C1)CCC(=O)O |
Computed by PubChem (NCBI)