Products 862372-15-4
CAS 862372-15-4 appears in our catalog under these names: Lacosamide Impurity 21, Lacosamide Impurity 43, Lacosamide Impurity 34. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2R)-3-methoxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid (CAS 862372-15-4) is a chemical compound with the molecular formula C10H19NO5 and a molecular weight of 233.26 g/mol. IUPAC name: (2R)-3-methoxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid. InChIKey: WEJGHAGAXIUQOF-SSDOTTSWSA-N.
| Molecular formula | C10H19NO5 |
|---|---|
| Molecular weight | 233.26 g/mol |
| IUPAC name | (2R)-3-methoxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
| InChIKey | WEJGHAGAXIUQOF-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)[C@H](COC)C(=O)O |
Computed by PubChem (NCBI)