Products 86317-09-1
CAS 86317-09-1 is the registry number for N,N-dimethyl-3-(methylamino)benzene-1-sulfonamide, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
N,N-dimethyl-3-(methylamino)benzenesulfonamide (CAS 86317-09-1) is a chemical compound with the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. IUPAC name: N,N-dimethyl-3-(methylamino)benzenesulfonamide. InChIKey: GLESQKJKDNIQIL-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2S |
|---|---|
| Molecular weight | 214.29 g/mol |
| IUPAC name | N,N-dimethyl-3-(methylamino)benzenesulfonamide |
| InChIKey | GLESQKJKDNIQIL-UHFFFAOYSA-N |
| SMILES | CNC1=CC(=CC=C1)S(=O)(=O)N(C)C |
Computed by PubChem (NCBI)