CAS 86320-44-7 appears in our catalog under these names: 1,5–Diacetyl–1,3,5–triazinane–2,4–dione, 1,5-Diacetyl-1,3,5-triazinane-2,4-dione, >98.0%(HPLC)(T), 1,5-diacetyl-1,3,5-triazinane-2,4-dione, 98.0%, 98.0%, 1,5-Diacetyl-1,3,5-triazinane-2,4-dione, 98%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 200mg, 5g.
1,5-diacetyl-1,3,5-triazinane-2,4-dione (CAS 86320-44-7) is a chemical compound with the molecular formula C7H9N3O4 and a molecular weight of 199.16 g/mol. IUPAC name: 1,5-diacetyl-1,3,5-triazinane-2,4-dione. InChIKey: LYPVKWMHGFMDPD-UHFFFAOYSA-N.
| Molecular formula | C7H9N3O4 |
|---|---|
| Molecular weight | 199.16 g/mol |
| IUPAC name | 1,5-diacetyl-1,3,5-triazinane-2,4-dione |
| InChIKey | LYPVKWMHGFMDPD-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CN(C(=O)NC1=O)C(=O)C |
Computed by PubChem (NCBI)