CAS 86344-75-4 appears in our catalog under these names: 2-Hydroxy-2,3-dihydro-1H-indene-2-carboxamide, 95%, 2-Hydroxy-2,3-dihydro-1H-indene-2-carboxamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-hydroxy-1,3-dihydroindene-2-carboxamide (CAS 86344-75-4) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 2-hydroxy-1,3-dihydroindene-2-carboxamide. InChIKey: MYIZSGVUGGHXPP-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 2-hydroxy-1,3-dihydroindene-2-carboxamide |
| InChIKey | MYIZSGVUGGHXPP-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2CC1(C(=O)N)O |
Computed by PubChem (NCBI)