CAS 863564-77-6 appears in our catalog under these names: 3-methyl-2-oxo-2,3-dihydro-1H-1,3-benzodiazole-5-carboxylic acid, 2,3-Dihydro-3-methyl-2-oxo-1H-benzimidazole-5-carboxylic acid, 95%, 95%, 3-Methyl-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylic acid, 95%. Offered by: Biosynth, Chemat, Ambeed. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g, 5g.
3-methyl-2-oxo-1H-benzimidazole-5-carboxylic acid (CAS 863564-77-6) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 3-methyl-2-oxo-1H-benzimidazole-5-carboxylic acid. InChIKey: QNGRDARNLFTZBH-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 3-methyl-2-oxo-1H-benzimidazole-5-carboxylic acid |
| InChIKey | QNGRDARNLFTZBH-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)C(=O)O)NC1=O |
Computed by PubChem (NCBI)