CAS 863669-54-9 is the registry number for Methyl 6-methyl-2-oxo-4-thioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 10g.
Methyl 6-methyl-2-oxo-4-sulfanylidene-1H-pyrimidine-5-carboxylate (CAS 863669-54-9) is a chemical compound with the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. IUPAC name: methyl 6-methyl-2-oxo-4-sulfanylidene-1H-pyrimidine-5-carboxylate. InChIKey: TURYTFWPSZFUCR-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3S |
|---|---|
| Molecular weight | 200.22 g/mol |
| IUPAC name | methyl 6-methyl-2-oxo-4-sulfanylidene-1H-pyrimidine-5-carboxylate |
| InChIKey | TURYTFWPSZFUCR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=S)NC(=O)N1)C(=O)OC |
Computed by PubChem (NCBI)