CAS 86455-98-3 is the registry number for 1–((2–(Dimethylamino)ethyl)amino)–7–hydroxy–4–(hydroxymethyl)–9H–xanthen–9–one. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
1-[2-(dimethylamino)ethylamino]-7-hydroxy-4-(hydroxymethyl)xanthen-9-one (CAS 86455-98-3) is a chemical compound with the molecular formula C18H20N2O4 and a molecular weight of 328.4 g/mol. IUPAC name: 1-[2-(dimethylamino)ethylamino]-7-hydroxy-4-(hydroxymethyl)xanthen-9-one. InChIKey: BOTXZPXSICDQHE-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O4 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | 1-[2-(dimethylamino)ethylamino]-7-hydroxy-4-(hydroxymethyl)xanthen-9-one |
| InChIKey | BOTXZPXSICDQHE-UHFFFAOYSA-N |
| SMILES | CN(C)CCNC1=C2C(=C(C=C1)CO)OC3=C(C2=O)C=C(C=C3)O |
Computed by PubChem (NCBI)