CAS 864754-11-0 is the registry number for 4,4,5,5-Tetramethyl-2-(2-(2,2,2-trifluoroethoxy)phenyl)-1,3,2-dioxaborolane, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4,4,5,5-tetramethyl-2-[2-(2,2,2-trifluoroethoxy)phenyl]-1,3,2-dioxaborolane (CAS 864754-11-0) is a chemical compound with the molecular formula C14H18BF3O3 and a molecular weight of 302.10 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[2-(2,2,2-trifluoroethoxy)phenyl]-1,3,2-dioxaborolane. InChIKey: CIZBVBYBRDMQNP-UHFFFAOYSA-N.
| Molecular formula | C14H18BF3O3 |
|---|---|
| Molecular weight | 302.10 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[2-(2,2,2-trifluoroethoxy)phenyl]-1,3,2-dioxaborolane |
| InChIKey | CIZBVBYBRDMQNP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2OCC(F)(F)F |
Computed by PubChem (NCBI)