CAS 865604-20-2 is the registry number for 3,4'–Bipyridin–2'–amine. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg, 5g.
4-pyridin-3-ylpyridin-2-amine (CAS 865604-20-2) is a chemical compound with the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. IUPAC name: 4-pyridin-3-ylpyridin-2-amine. InChIKey: VZSPRDGYHFGDAY-UHFFFAOYSA-N.
| Molecular formula | C10H9N3 |
|---|---|
| Molecular weight | 171.20 g/mol |
| IUPAC name | 4-pyridin-3-ylpyridin-2-amine |
| InChIKey | VZSPRDGYHFGDAY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=CC(=NC=C2)N |
Computed by PubChem (NCBI)