Products 865886-83-5
CAS 865886-83-5 is the registry number for 2-Bromo-4-(difluoromethoxy)-1-nitrobenzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-bromo-4-(difluoromethoxy)-1-nitrobenzene (CAS 865886-83-5) is a chemical compound with the molecular formula C7H4BrF2NO3 and a molecular weight of 268.01 g/mol. IUPAC name: 2-bromo-4-(difluoromethoxy)-1-nitrobenzene. InChIKey: YCHHHSKECOAFTB-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF2NO3 |
|---|---|
| Molecular weight | 268.01 g/mol |
| IUPAC name | 2-bromo-4-(difluoromethoxy)-1-nitrobenzene |
| InChIKey | YCHHHSKECOAFTB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)F)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)