CAS 865887-02-1 appears in our catalog under these names: 4-Methoxy-1H-indazole-3-carboxylic Acid, 4-Methoxy-1H-indazole-3-carboxylic acid, 98+%. Offered by: TRC, AmBeed. Available pack sizes: 100mg, 10g, 5g.
4-methoxy-1H-indazole-3-carboxylic acid (CAS 865887-02-1) is a chemical compound with the molecular formula C9H8N2O3 and a molecular weight of 192.17 g/mol. IUPAC name: 4-methoxy-1H-indazole-3-carboxylic acid. InChIKey: UNCWFHMSYTUYDL-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 4-methoxy-1H-indazole-3-carboxylic acid |
| InChIKey | UNCWFHMSYTUYDL-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C(=NN2)C(=O)O |
Computed by PubChem (NCBI)