CAS 86603-94-3 appears in our catalog under these names: 2-(6-Methoxynaphthalen-2-yl)propanenitrile, >95% (HPLC), 2-(6-Methoxynaphthalen-2-yl)propanenitrile. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 500mg, 50mg, 0,5g.
2-(6-methoxynaphthalen-2-yl)propanenitrile (CAS 86603-94-3) is a chemical compound with the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. IUPAC name: 2-(6-methoxynaphthalen-2-yl)propanenitrile. InChIKey: QAILMFURFUYAJA-UHFFFAOYSA-N.
| Molecular formula | C14H13NO |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | 2-(6-methoxynaphthalen-2-yl)propanenitrile |
| InChIKey | QAILMFURFUYAJA-UHFFFAOYSA-N |
| SMILES | CC(C#N)C1=CC2=C(C=C1)C=C(C=C2)OC |
Computed by PubChem (NCBI)