Products 86606-14-6
CAS 86606-14-6 appears in our catalog under these names: 6–Benzoyl–5，7–dihydroxy–2，2–dimethylchromane, 6-Benzoyl-5,7-dihydroxy-2,2-dimethylchromane. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
(5,7-dihydroxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)-phenylmethanone (CAS 86606-14-6) is a chemical compound with the molecular formula C18H18O4 and a molecular weight of 298.3 g/mol. IUPAC name: (5,7-dihydroxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)-phenylmethanone. InChIKey: IZKXPLQWLQOBPG-UHFFFAOYSA-N.
| Molecular formula | C18H18O4 |
|---|---|
| Molecular weight | 298.3 g/mol |
| IUPAC name | (5,7-dihydroxy-2,2-dimethyl-3,4-dihydrochromen-6-yl)-phenylmethanone |
| InChIKey | IZKXPLQWLQOBPG-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(O1)C=C(C(=C2O)C(=O)C3=CC=CC=C3)O)C |
Computed by PubChem (NCBI)