Products 86630-46-8
CAS 86630-46-8 appears in our catalog under these names: Nudol, 99.60%, 3,4-Dimethoxyphenanthrene-2,7-diol, ≥98%. Offered by: MedChemExpress, Chemat. Available pack sizes: 5 mg, 1 mg, 5mg.
3,4-dimethoxyphenanthrene-2,7-diol (CAS 86630-46-8) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: 3,4-dimethoxyphenanthrene-2,7-diol. InChIKey: JZIYNZGPIKGKQC-UHFFFAOYSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 3,4-dimethoxyphenanthrene-2,7-diol |
| InChIKey | JZIYNZGPIKGKQC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C=CC3=C(C2=C1OC)C=CC(=C3)O)O |
Computed by PubChem (NCBI)