Products 86654-26-4
CAS 86654-26-4 is the registry number for 7-Hydroxy-3-prenylcoumarin. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5000mg, Get quote.
7-hydroxy-3-(3-methylbut-2-enyl)chromen-2-one (CAS 86654-26-4) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. IUPAC name: 7-hydroxy-3-(3-methylbut-2-enyl)chromen-2-one. InChIKey: BOTVZVKUYCAWMF-UHFFFAOYSA-N.
| Molecular formula | C14H14O3 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 7-hydroxy-3-(3-methylbut-2-enyl)chromen-2-one |
| InChIKey | BOTVZVKUYCAWMF-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=CC2=C(C=C(C=C2)O)OC1=O)C |
Computed by PubChem (NCBI)