CAS 866620-28-2 appears in our catalog under these names: 5-(2-Thienyl)-2-pyridinamine, 5-(Thiophen-2-yl)pyridin-2-amine. Offered by: TRC, Chemat Brand. Available pack sizes: 500mg, on request.
5-thiophen-2-ylpyridin-2-amine (CAS 866620-28-2) is a chemical compound with the molecular formula C9H8N2S and a molecular weight of 176.24 g/mol. IUPAC name: 5-thiophen-2-ylpyridin-2-amine. InChIKey: KNJGVOPPASUVMZ-UHFFFAOYSA-N.
| Molecular formula | C9H8N2S |
|---|---|
| Molecular weight | 176.24 g/mol |
| IUPAC name | 5-thiophen-2-ylpyridin-2-amine |
| InChIKey | KNJGVOPPASUVMZ-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CN=C(C=C2)N |
Computed by PubChem (NCBI)