Products 866832-48-6
CAS 866832-48-6 is the registry number for (2R,4R)-1-Boc-4-(2-methoxyethoxy)pyrrolidine-2-carboxylic Acid, >95%. Offered by: Chemat. Available pack sizes: 100mg.
(2R,4R)-4-(2-methoxyethoxy)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 866832-48-6) is a chemical compound with the molecular formula C13H23NO6 and a molecular weight of 289.32 g/mol. IUPAC name: (2R,4R)-4-(2-methoxyethoxy)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: YPNXFLHBKLKLTO-NXEZZACHSA-N.
| Molecular formula | C13H23NO6 |
|---|---|
| Molecular weight | 289.32 g/mol |
| IUPAC name | (2R,4R)-4-(2-methoxyethoxy)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | YPNXFLHBKLKLTO-NXEZZACHSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@@H]1C(=O)O)OCCOC |
Computed by PubChem (NCBI)