Products 86685-95-2
CAS 86685-95-2 is the registry number for 3-(3-chlorophenyl)-5-isoxazolamine, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-(3-chlorophenyl)-1,2-oxazol-5-amine (CAS 86685-95-2) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 3-(3-chlorophenyl)-1,2-oxazol-5-amine. InChIKey: LSTPIZJDZXGQFB-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 3-(3-chlorophenyl)-1,2-oxazol-5-amine |
| InChIKey | LSTPIZJDZXGQFB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NOC(=C2)N |
Computed by PubChem (NCBI)