Products 86780-25-8
CAS 86780-25-8 appears in our catalog under these names: Fast red KL salt, Fast Red KL salt, 25.00%. Offered by: Biosynth, Chemat. Available pack sizes: 2g, 5g, 10g, 25g, 50g.
2-carbamoyl-5-methoxybenzenediazonium chloride (CAS 86780-25-8) is a chemical compound with the molecular formula C8H8ClN3O2 and a molecular weight of 213.62 g/mol. IUPAC name: 2-carbamoyl-5-methoxybenzenediazonium chloride. InChIKey: LPTBOYZVJIBCPQ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3O2 |
|---|---|
| Molecular weight | 213.62 g/mol |
| IUPAC name | 2-carbamoyl-5-methoxybenzenediazonium chloride |
| InChIKey | LPTBOYZVJIBCPQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)N)[N+]#N.[Cl-] |
Computed by PubChem (NCBI)