CAS 86811-36-1 appears in our catalog under these names: PT-262, 98%, PT-262, PT–262, PT-262 98%, PT-262, 99.21%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 2mg, 10mg, 100mg, 25mg, 50mg, 250mg, 1mg.
7-chloro-6-piperidin-1-ylquinoline-5,8-dione (CAS 86811-36-1) is a chemical compound with the molecular formula C14H13ClN2O2 and a molecular weight of 276.72 g/mol. IUPAC name: 7-chloro-6-piperidin-1-ylquinoline-5,8-dione. InChIKey: XBHXHCMFAUSIKK-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2O2 |
|---|---|
| Molecular weight | 276.72 g/mol |
| IUPAC name | 7-chloro-6-piperidin-1-ylquinoline-5,8-dione |
| InChIKey | XBHXHCMFAUSIKK-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=C(C(=O)C3=C(C2=O)C=CC=N3)Cl |
Computed by PubChem (NCBI)