CAS 868171-67-9 appears in our catalog under these names: 1-(4-Fluorophenyl-1,2-dihydro-2-oxo-3-pyridinecarboxylic acid, 95+%, 95+%, 1-(4-FLUOROPHENYL)-2-OXO-1,2-DIHYDROPYRIDINE-3-CARBOXYLIC ACID, 97%, 1-(4-Fluorophenyl)-2-oxo-1,2-dihydropyridine-3-carboxylic acid, 95+%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(4-fluorophenyl)-2-oxopyridine-3-carboxylic acid (CAS 868171-67-9) is a chemical compound with the molecular formula C12H8FNO3 and a molecular weight of 233.19 g/mol. IUPAC name: 1-(4-fluorophenyl)-2-oxopyridine-3-carboxylic acid. InChIKey: WPJGHIVGAOVUAT-UHFFFAOYSA-N.
| Molecular formula | C12H8FNO3 |
|---|---|
| Molecular weight | 233.19 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-2-oxopyridine-3-carboxylic acid |
| InChIKey | WPJGHIVGAOVUAT-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=O)C(=C1)C(=O)O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)