CAS 86826-93-9 appears in our catalog under these names: 2-(2-Bromo-5-methoxyphenyl)acetic acid, 98%, 2–(2–Bromo–5–methoxyphenyl)acetic acid, 2-(2-bromo-5-methoxyphenyl)acetic acid, (2-Bromo-5-methoxyphenyl)acetic acid, 97%, 2-(2-Bromo-5-methoxyphenyl)acetic acid, 95+%. Offered by: Combi-blocks, GLPBio, Biosynth, Fluorochem, Ambeed. Available pack sizes: 25g, 250mg, 1g, 5g, 100mg, 10g.
2-(2-bromo-5-methoxyphenyl)acetic acid (CAS 86826-93-9) is a chemical compound with the molecular formula C9H9BrO3 and a molecular weight of 245.07 g/mol. IUPAC name: 2-(2-bromo-5-methoxyphenyl)acetic acid. InChIKey: XEXHAKGPISSIIX-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO3 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 2-(2-bromo-5-methoxyphenyl)acetic acid |
| InChIKey | XEXHAKGPISSIIX-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)Br)CC(=O)O |
Computed by PubChem (NCBI)