CAS 868280-61-9 appears in our catalog under these names: 1-(4-(1,3-Dioxolan-2-yl)phenyl)-2-phenylethanone, 97%, Ethanone, 1–(4–(1,3–dioxolan–2–yl)phenyl)–2–phenyl–. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 200mg.
1-[4-(1,3-dioxolan-2-yl)phenyl]-2-phenylethanone (CAS 868280-61-9) is a chemical compound with the molecular formula C17H16O3 and a molecular weight of 268.31 g/mol. IUPAC name: 1-[4-(1,3-dioxolan-2-yl)phenyl]-2-phenylethanone. InChIKey: TWYPADIZPGCRQW-UHFFFAOYSA-N.
| Molecular formula | C17H16O3 |
|---|---|
| Molecular weight | 268.31 g/mol |
| IUPAC name | 1-[4-(1,3-dioxolan-2-yl)phenyl]-2-phenylethanone |
| InChIKey | TWYPADIZPGCRQW-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC=C(C=C2)C(=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)