Products 869371-36-8
CAS 869371-36-8 is the registry number for n-(3-(Aminomethyl)phenyl)-N-methylmethanesulfonamide, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
N-[3-(aminomethyl)phenyl]-N-methylmethanesulfonamide (CAS 869371-36-8) is a chemical compound with the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. IUPAC name: N-[3-(aminomethyl)phenyl]-N-methylmethanesulfonamide. InChIKey: FPMZSXRKEASVJR-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2S |
|---|---|
| Molecular weight | 214.29 g/mol |
| IUPAC name | N-[3-(aminomethyl)phenyl]-N-methylmethanesulfonamide |
| InChIKey | FPMZSXRKEASVJR-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=CC(=C1)CN)S(=O)(=O)C |
Computed by PubChem (NCBI)