CAS 869943-67-9 is the registry number for 5-Fluoro-2-((furan-2-yl)methoxy)aniline. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-fluoro-2-(furan-2-ylmethoxy)aniline (CAS 869943-67-9) is a chemical compound with the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. IUPAC name: 5-fluoro-2-(furan-2-ylmethoxy)aniline. InChIKey: CYDYROXKLBOSNI-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO2 |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | 5-fluoro-2-(furan-2-ylmethoxy)aniline |
| InChIKey | CYDYROXKLBOSNI-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)COC2=C(C=C(C=C2)F)N |
Computed by PubChem (NCBI)