CAS 869945-03-9 is the registry number for N-(2-Aminophenyl)-N-ethylmethanesulfonamide, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-(2-aminophenyl)-N-ethylmethanesulfonamide (CAS 869945-03-9) is a chemical compound with the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. IUPAC name: N-(2-aminophenyl)-N-ethylmethanesulfonamide. InChIKey: QLUNGUFYCBYEBM-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2S |
|---|---|
| Molecular weight | 214.29 g/mol |
| IUPAC name | N-(2-aminophenyl)-N-ethylmethanesulfonamide |
| InChIKey | QLUNGUFYCBYEBM-UHFFFAOYSA-N |
| SMILES | CCN(C1=CC=CC=C1N)S(=O)(=O)C |
Computed by PubChem (NCBI)