Products 870289-72-8
CAS 870289-72-8 appears in our catalog under these names: 2,5-Dioxopyrrolidin-1-yl 4-ethynylbenzoate, 99%, 2,5-dioxopyrrolidin-1-yl4-ethynylbenzoate, 98%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 100mg.
(2,5-dioxopyrrolidin-1-yl) 4-ethynylbenzoate (CAS 870289-72-8) is a chemical compound with the molecular formula C13H9NO4 and a molecular weight of 243.21 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 4-ethynylbenzoate. InChIKey: QADQHKRQMCXWEN-UHFFFAOYSA-N.
| Molecular formula | C13H9NO4 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 4-ethynylbenzoate |
| InChIKey | QADQHKRQMCXWEN-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=C(C=C1)C(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)