CAS 87039-48-3 is the registry number for 6-Methoxy-5-nitroquinazoline, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
6-methoxy-5-nitroquinazoline (CAS 87039-48-3) is a chemical compound with the molecular formula C9H7N3O3 and a molecular weight of 205.17 g/mol. IUPAC name: 6-methoxy-5-nitroquinazoline. InChIKey: CNDJORSHNJUFTO-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O3 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 6-methoxy-5-nitroquinazoline |
| InChIKey | CNDJORSHNJUFTO-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=CN=CN=C2C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)