Products 870762-87-1
CAS 870762-87-1 is the registry number for WAY-326439-10mMinDMSO,,, ≥95%. Offered by: Chemat. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg.
1-cyclopentyl-3-[2-(2,4-dimethoxyphenyl)-2-oxoethyl]imidazolidine-2,4,5-trione (CAS 870762-87-1) is a chemical compound with the molecular formula C18H20N2O6 and a molecular weight of 360.4 g/mol. IUPAC name: 1-cyclopentyl-3-[2-(2,4-dimethoxyphenyl)-2-oxoethyl]imidazolidine-2,4,5-trione. InChIKey: XFFIYIMTOWNVRE-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O6 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 1-cyclopentyl-3-[2-(2,4-dimethoxyphenyl)-2-oxoethyl]imidazolidine-2,4,5-trione |
| InChIKey | XFFIYIMTOWNVRE-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)CN2C(=O)C(=O)N(C2=O)C3CCCC3)OC |
Computed by PubChem (NCBI)