CAS 871224-19-0 appears in our catalog under these names: Methyl 3-bromo-2-chlorobenzoate, 95%, 95%, Methyl 3-bromo-2-chlorobenzoate, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 100g, 250mg, 1g, 5g, 10g, 25g.
Methyl 3-bromo-2-chlorobenzoate (CAS 871224-19-0) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: methyl 3-bromo-2-chlorobenzoate. InChIKey: OWPJVOSLLKRKQJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | methyl 3-bromo-2-chlorobenzoate |
| InChIKey | OWPJVOSLLKRKQJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)Br)Cl |
Computed by PubChem (NCBI)