Products 871731-76-9
CAS 871731-76-9 is the registry number for Tert-butyl acetyl(3-acetyl-7-methoxynaphthalen-1-yl)carbamate, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg.
Tert-butyl N-acetyl-N-(3-acetyl-7-methoxynaphthalen-1-yl)carbamate (CAS 871731-76-9) is a chemical compound with the molecular formula C20H23NO5 and a molecular weight of 357.4 g/mol. IUPAC name: tert-butyl N-acetyl-N-(3-acetyl-7-methoxynaphthalen-1-yl)carbamate. InChIKey: GTVALBVJKOAQEC-UHFFFAOYSA-N.
| Molecular formula | C20H23NO5 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | tert-butyl N-acetyl-N-(3-acetyl-7-methoxynaphthalen-1-yl)carbamate |
| InChIKey | GTVALBVJKOAQEC-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C2C=C(C=CC2=C1)OC)N(C(=O)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)