Products 871878-59-0
CAS 871878-59-0 is the registry number for N-(4-Bromo-5-Methoxy-2-Methylphenyl)Acetamide, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-(4-bromo-5-methoxy-2-methylphenyl)acetamide (CAS 871878-59-0) is a chemical compound with the molecular formula C10H12BrNO2 and a molecular weight of 258.11 g/mol. IUPAC name: N-(4-bromo-5-methoxy-2-methylphenyl)acetamide. InChIKey: IFEYCXFJRLYXIG-UHFFFAOYSA-N.
| Molecular formula | C10H12BrNO2 |
|---|---|
| Molecular weight | 258.11 g/mol |
| IUPAC name | N-(4-bromo-5-methoxy-2-methylphenyl)acetamide |
| InChIKey | IFEYCXFJRLYXIG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1NC(=O)C)OC)Br |
Computed by PubChem (NCBI)