CAS 872277-65-1 is the registry number for 2,6-Dichloro-3-methylbenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,6-dichloro-3-methylbenzenesulfonamide (CAS 872277-65-1) is a chemical compound with the molecular formula C7H7Cl2NO2S and a molecular weight of 240.11 g/mol. IUPAC name: 2,6-dichloro-3-methylbenzenesulfonamide. InChIKey: ICAASQSIDWYDOR-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2NO2S |
|---|---|
| Molecular weight | 240.11 g/mol |
| IUPAC name | 2,6-dichloro-3-methylbenzenesulfonamide |
| InChIKey | ICAASQSIDWYDOR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)Cl)S(=O)(=O)N)Cl |
Computed by PubChem (NCBI)