Products 873055-55-1
CAS 873055-55-1 appears in our catalog under these names: Ivacaftor Impurity 4, 2,4-Di-tert-butyl-5-nitrophenyl methyl carbonate 97%, 2,4-Di-tert-butyl-5-nitrophenyl methyl carbonate, 98%. Offered by: Chemat Brand, Ambeed, Fluorochem. Available pack sizes: on request, 250mg, 1g, 5g, 10g.
(2,4-ditert-butyl-5-nitrophenyl) methyl carbonate (CAS 873055-55-1) is a chemical compound with the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. IUPAC name: (2,4-ditert-butyl-5-nitrophenyl) methyl carbonate. InChIKey: QBDLLAFFRJOLHZ-UHFFFAOYSA-N.
| Molecular formula | C16H23NO5 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | (2,4-ditert-butyl-5-nitrophenyl) methyl carbonate |
| InChIKey | QBDLLAFFRJOLHZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1[N+](=O)[O-])OC(=O)OC)C(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
(2,4-ditert-butyl-5-nitrophenyl) methyl carbonate, carbonic acid 2,4-di-tert-butyl-5-nitro-phenyl ester methyl ester, Carbonic acid, 2,4-bis(1,1-dimethylethyl)-5-nitrophenyl methyl ester, 2,4-di-tert-butyl-5-nitrophenylmethylcarbonate, QBDLLAFFRJOLHZ-UHFFFAOYSA-N, 2,4-Di-t-butyl-5-nitrophenyl methyl carbonate, 5-nitro-2,4-di-tert-butylphenyl methyl carbonate, (2,4-ditert-butyl-5-nitro-phenyl) methyl carbonate