CAS 874571-72-9 is the registry number for 2-Chloro-4-(trifluoromethoxy)benzenemethanamine. Offered by: TRC. Available pack sizes: 2,5g.
[2-chloro-4-(trifluoromethoxy)phenyl]methanamine (CAS 874571-72-9) is a chemical compound with the molecular formula C8H7ClF3NO and a molecular weight of 225.59 g/mol. IUPAC name: [2-chloro-4-(trifluoromethoxy)phenyl]methanamine. InChIKey: PGMDWCRSNWLKIU-UHFFFAOYSA-N.
| Molecular formula | C8H7ClF3NO |
|---|---|
| Molecular weight | 225.59 g/mol |
| IUPAC name | [2-chloro-4-(trifluoromethoxy)phenyl]methanamine |
| InChIKey | PGMDWCRSNWLKIU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)Cl)CN |
Computed by PubChem (NCBI)