Products 874774-41-1
CAS 874774-41-1 appears in our catalog under these names: 2-Amino-3-bromo-5-(trifluoromethoxy)benzoic acid, 98%+(LC-MS),RG, 98%+(LC-MS),RG, 2-Amino-3-bromo-5-(trifluoromethoxy)benzoic acid, 95.0%, 2-Amino-3-Bromo-5-(Trifluoromethoxy)Benzoic Acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 5g, 25g, 250mg, 1g.
2-amino-3-bromo-5-(trifluoromethoxy)benzoic acid (CAS 874774-41-1) is a chemical compound with the molecular formula C8H5BrF3NO3 and a molecular weight of 300.03 g/mol. IUPAC name: 2-amino-3-bromo-5-(trifluoromethoxy)benzoic acid. InChIKey: QQAWRUJXYLTDOJ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF3NO3 |
|---|---|
| Molecular weight | 300.03 g/mol |
| IUPAC name | 2-amino-3-bromo-5-(trifluoromethoxy)benzoic acid |
| InChIKey | QQAWRUJXYLTDOJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)N)Br)OC(F)(F)F |
Computed by PubChem (NCBI)