CAS 875003-50-2 appears in our catalog under these names: 5-Amino-1-ethylindolin-2-one, 95+%, 5-Amino-1-ethyl-2,3-dihydro-1H-indol-2-one, 98%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
5-amino-1-ethyl-3H-indol-2-one (CAS 875003-50-2) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: 5-amino-1-ethyl-3H-indol-2-one. InChIKey: PYVVLSILSIVNQC-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 5-amino-1-ethyl-3H-indol-2-one |
| InChIKey | PYVVLSILSIVNQC-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)CC2=C1C=CC(=C2)N |
Computed by PubChem (NCBI)