Products 875779-49-0
CAS 875779-49-0 appears in our catalog under these names: 1-Benzyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylic acid, 97%, 1-Benzyl-4-phenyl-1,4-dihydropyridine-3,5-dicarboxylic Acid, ≥95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg.
1-benzyl-4-phenyl-4H-pyridine-3,5-dicarboxylic acid (CAS 875779-49-0) is a chemical compound with the molecular formula C20H17NO4 and a molecular weight of 335.4 g/mol. IUPAC name: 1-benzyl-4-phenyl-4H-pyridine-3,5-dicarboxylic acid. InChIKey: HWACVLDYTNGISW-UHFFFAOYSA-N.
| Molecular formula | C20H17NO4 |
|---|---|
| Molecular weight | 335.4 g/mol |
| IUPAC name | 1-benzyl-4-phenyl-4H-pyridine-3,5-dicarboxylic acid |
| InChIKey | HWACVLDYTNGISW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=C(C(C(=C2)C(=O)O)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)