CAS 876-86-8 appears in our catalog under these names: 7–Chloroquinolin–8–ol, 7-Chloroquinolin-8-ol 97%, 7-Chloroquinolin-8-ol, 97%, 7-Chloro-8-quinolinol, >95% (HPLC), 7-Chloroquinolin-8-Ol, 97%, 97%. Offered by: GLPBio, Ambeed, Fluorochem, TRC, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg, 50mg.
7-chloroquinolin-8-ol (CAS 876-86-8) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 7-chloroquinolin-8-ol. InChIKey: RMJFNYXBFISIET-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 7-chloroquinolin-8-ol |
| InChIKey | RMJFNYXBFISIET-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C(C=C2)Cl)O)N=C1 |
Computed by PubChem (NCBI)