CAS 876191-56-9 appears in our catalog under these names: 4-N-Boc amino-3-methyl isothiazole, 95%, tert-Butyl (3-methylisothiazol-4-yl)carbamate, 97%, (3-Methyl-isothiazol-4-yl)-carbamic acid tert-butyl ester, 4-N-BOC AMINO-3-METHYL ISOTHIAZOLE, 97%, 97%, (3-methyl-isothiaZol-4-yl)-carbamic acid tert-butyl ester, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 50mg, 0,5g, 100mg, 500mg.
Tert-butyl N-(3-methyl-1,2-thiazol-4-yl)carbamate (CAS 876191-56-9) is a chemical compound with the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. IUPAC name: tert-butyl N-(3-methyl-1,2-thiazol-4-yl)carbamate. InChIKey: KIQMUEBPBWDMKO-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2S |
|---|---|
| Molecular weight | 214.29 g/mol |
| IUPAC name | tert-butyl N-(3-methyl-1,2-thiazol-4-yl)carbamate |
| InChIKey | KIQMUEBPBWDMKO-UHFFFAOYSA-N |
| SMILES | CC1=NSC=C1NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)