Products 876305-36-1
CAS 876305-36-1 is the registry number for Montixanthone. Offered by: MedChemExpress. Available pack sizes: Get quote.
3,6,7-trihydroxy-1-methoxyxanthen-9-one (CAS 876305-36-1) is a chemical compound with the molecular formula C14H10O6 and a molecular weight of 274.22 g/mol. IUPAC name: 3,6,7-trihydroxy-1-methoxyxanthen-9-one. InChIKey: NHQMTEDPFLHWEG-UHFFFAOYSA-N.
| Molecular formula | C14H10O6 |
|---|---|
| Molecular weight | 274.22 g/mol |
| IUPAC name | 3,6,7-trihydroxy-1-methoxyxanthen-9-one |
| InChIKey | NHQMTEDPFLHWEG-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC2=C1C(=O)C3=CC(=C(C=C3O2)O)O)O |
Computed by PubChem (NCBI)