CAS 876372-87-1 is the registry number for 6-Bromo-3-(tert-butyl)-(1,2,4)triazolo(4,3-a)pyridine, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
6-bromo-3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridine (CAS 876372-87-1) is a chemical compound with the molecular formula C10H12BrN3 and a molecular weight of 254.13 g/mol. IUPAC name: 6-bromo-3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridine. InChIKey: QWESYQIJNLIFRH-UHFFFAOYSA-N.
| Molecular formula | C10H12BrN3 |
|---|---|
| Molecular weight | 254.13 g/mol |
| IUPAC name | 6-bromo-3-tert-butyl-[1,2,4]triazolo[4,3-a]pyridine |
| InChIKey | QWESYQIJNLIFRH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN=C2N1C=C(C=C2)Br |
Computed by PubChem (NCBI)