CAS 87657-91-8 appears in our catalog under these names: 2-Phenyl-1,3-thiazol-5-amine, 95%, 2-Phenyl-1,3-thiazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-phenyl-1,3-thiazol-5-amine (CAS 87657-91-8) is a chemical compound with the molecular formula C9H8N2S and a molecular weight of 176.24 g/mol. IUPAC name: 2-phenyl-1,3-thiazol-5-amine. InChIKey: CFLMSQYWGWBIHE-UHFFFAOYSA-N.
| Molecular formula | C9H8N2S |
|---|---|
| Molecular weight | 176.24 g/mol |
| IUPAC name | 2-phenyl-1,3-thiazol-5-amine |
| InChIKey | CFLMSQYWGWBIHE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C(S2)N |
Computed by PubChem (NCBI)