Products 877236-29-8
CAS 877236-29-8 is the registry number for benzyl 3-(furan-2-yl)-3-oxopropanoate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Benzyl 3-(furan-2-yl)-3-oxopropanoate (CAS 877236-29-8) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: benzyl 3-(furan-2-yl)-3-oxopropanoate. InChIKey: KNEQGUSKCWRJOM-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | benzyl 3-(furan-2-yl)-3-oxopropanoate |
| InChIKey | KNEQGUSKCWRJOM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CC(=O)C2=CC=CO2 |
Computed by PubChem (NCBI)
Synonyms:
benzyl 3-(furan-2-yl)-3-oxopropanoate