Products 877761-15-4
CAS 877761-15-4 is the registry number for (2R,5S)-Thiolane-2,5-dicarboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2R,5S)-thiolane-2,5-dicarboxylic acid (CAS 877761-15-4) is a chemical compound with the molecular formula C6H8O4S and a molecular weight of 176.19 g/mol. IUPAC name: (2R,5S)-thiolane-2,5-dicarboxylic acid. InChIKey: VZKPHLAASBCFGX-ZXZARUISSA-N.
| Molecular formula | C6H8O4S |
|---|---|
| Molecular weight | 176.19 g/mol |
| IUPAC name | (2R,5S)-thiolane-2,5-dicarboxylic acid |
| InChIKey | VZKPHLAASBCFGX-ZXZARUISSA-N |
| SMILES | C1C[C@H](S[C@H]1C(=O)O)C(=O)O |
Computed by PubChem (NCBI)