Products 877774-65-7
CAS 877774-65-7 is the registry number for 7-[(2-Oxocyclopentyl)oxy]-2H-1-benzopyran-2-one. Offered by: Chemat. Available pack sizes: 100mg, 10mg.
7-(2-oxocyclopentyl)oxychromen-2-one (CAS 877774-65-7) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: 7-(2-oxocyclopentyl)oxychromen-2-one. InChIKey: QFUMPNFYILIPHF-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | 7-(2-oxocyclopentyl)oxychromen-2-one |
| InChIKey | QFUMPNFYILIPHF-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)C1)OC2=CC3=C(C=C2)C=CC(=O)O3 |
Computed by PubChem (NCBI)