CAS 877861-62-6 appears in our catalog under these names: Methyl 1,2,3,4-tetrahydroisoquinoline-6-carboxylate hydrochloride 96%, Methyl 1,2,3,4-tetrahydroisoquinoline-6-carboxylate hydrochloride, 97%, Lifitegrast Impurity 48, 1,2,3,4-Tetrahydro-isoquinoline-6-carboxylic acid methyl ester hydrochloride, 96%, 96%. Offered by: Ambeed, Fluorochem, Chemat Brand, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, on request.
Methyl 1,2,3,4-tetrahydroisoquinoline-6-carboxylate;hydrochloride (CAS 877861-62-6) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: methyl 1,2,3,4-tetrahydroisoquinoline-6-carboxylate;hydrochloride. InChIKey: YQROFCVHUWWCQO-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO2 |
|---|---|
| Molecular weight | 227.69 g/mol |
| IUPAC name | methyl 1,2,3,4-tetrahydroisoquinoline-6-carboxylate;hydrochloride |
| InChIKey | YQROFCVHUWWCQO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(CNCC2)C=C1.Cl |
Computed by PubChem (NCBI)