Products 87830-28-2
CAS 87830-28-2 appears in our catalog under these names: Cubane–1，4–diamine dihydrochloride, Cubane-1,4-diamine dihydrochloride, Cubane-1,4-diamine dihydrochloride 98%, Cubane-1，4-diamine dihydrochloride, 98%(HPLC),RG, 98%(HPLC),RG. Offered by: GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 0,05g, 0,025g, 0,1g, 0,25g.
Cubane-1,4-diamine;dihydrochloride (CAS 87830-28-2) is a chemical compound with the molecular formula C8H12Cl2N2 and a molecular weight of 207.10 g/mol. IUPAC name: cubane-1,4-diamine;dihydrochloride. InChIKey: XPDHJELXCHPFPS-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N2 |
|---|---|
| Molecular weight | 207.10 g/mol |
| IUPAC name | cubane-1,4-diamine;dihydrochloride |
| InChIKey | XPDHJELXCHPFPS-UHFFFAOYSA-N |
| SMILES | C12C3C4C1(C5C2C3(C45)N)N.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
Cubane-1,4-diamine dihydrochloride, 1,4-diaminocubane dihydrochloride, cubane-1,4-diamine;dihydrochloride, Pentacyclo[4.2.0.02,5.03,8.04,7]octane-1,4-diamine, dihydrochloride, cubane-1,8-diamine dihydrochloride, Cubane-1,4-diamine diHCl, 1,4-Diaminocubanedihydrochloride, Cubane-14-diamine dihydrochloride